C17H21F3N2O3 — CID 122121679
5-methyl-1-[1-oxo-1-[4-(trifluoromethyl)anilino]propan-2-yl]piperidine-3-carboxylic acid (PubChem CID 122121679) has the molecular formula C17H21F3N2O3 and a molecular weight of 358.36 g/mol. Its IUPAC name is 5-methyl-1-[1-oxo-1-[4-(trifluoromethyl)anilino]propan-2-yl]piperidine-3-carboxylic acid.
| Compound Name | 5-methyl-1-[1-oxo-1-[4-(trifluoromethyl)anilino]propan-2-yl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122121679 |
| Molecular Formula | C17H21F3N2O3 |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 5-methyl-1-[1-oxo-1-[4-(trifluoromethyl)anilino]propan-2-yl]piperidine-3-carboxylic acid |
| SMILES | CC1CC(C(=O)O)CN(C(C)C(=O)Nc2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C17H21F3N2O3/c1-10-7-12(16(24)25)9-22(8-10)11(2)15(23)21-14-5-3-13(4-6-14)17(18,19)20/h3-6,10-12H,7-9H2,1-2H3,(H,21,23)(H,24,25) |
| InChIKey | BDTLPTZGKMAHPT-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |