C18H23ClN2O3 — CID 122123979
1-[[3-(2-chlorophenyl)cyclobutyl]carbamoyl]-5-methylpiperidine-3-carboxylic acid (PubChem CID 122123979) has the molecular formula C18H23ClN2O3 and a molecular weight of 350.85 g/mol. Its IUPAC name is 1-[[3-(2-chlorophenyl)cyclobutyl]carbamoyl]-5-methylpiperidine-3-carboxylic acid.
| Compound Name | 1-[[3-(2-chlorophenyl)cyclobutyl]carbamoyl]-5-methylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122123979 |
| Molecular Formula | C18H23ClN2O3 |
| Molecular Weight | 350.85 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 1-[[3-(2-chlorophenyl)cyclobutyl]carbamoyl]-5-methylpiperidine-3-carboxylic acid |
| SMILES | CC1CC(C(=O)O)CN(C(=O)NC2CC(c3ccccc3Cl)C2)C1 |
| InChI | InChI=1S/C18H23ClN2O3/c1-11-6-13(17(22)23)10-21(9-11)18(24)20-14-7-12(8-14)15-4-2-3-5-16(15)19/h2-5,11-14H,6-10H2,1H3,(H,20,24)(H,22,23) |
| InChIKey | VJGNYVJHMKVGHT-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.85 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |