C13H25N3O5S — CID 122124026
1-[1-(methanesulfonamido)butan-2-ylcarbamoyl]-5-methylpiperidine-3-carboxylic acid (PubChem CID 122124026) has the molecular formula C13H25N3O5S and a molecular weight of 335.43 g/mol. Its IUPAC name is 1-[1-(methanesulfonamido)butan-2-ylcarbamoyl]-5-methylpiperidine-3-carboxylic acid.
| Compound Name | 1-[1-(methanesulfonamido)butan-2-ylcarbamoyl]-5-methylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122124026 |
| Molecular Formula | C13H25N3O5S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 1-[1-(methanesulfonamido)butan-2-ylcarbamoyl]-5-methylpiperidine-3-carboxylic acid |
| SMILES | CCC(CNS(C)(=O)=O)NC(=O)N1CC(C)CC(C(=O)O)C1 |
| InChI | InChI=1S/C13H25N3O5S/c1-4-11(6-14-22(3,20)21)15-13(19)16-7-9(2)5-10(8-16)12(17)18/h9-11,14H,4-8H2,1-3H3,(H,15,19)(H,17,18) |
| InChIKey | XBJFYVVSWYYTCS-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |