C17H19ClN2O2 — CID 122124482
1-[(6-chloroquinolin-8-yl)methyl]-6-methylpiperidine-3-carboxylic acid (PubChem CID 122124482) has the molecular formula C17H19ClN2O2 and a molecular weight of 318.80 g/mol. Its IUPAC name is 1-[(6-chloroquinolin-8-yl)methyl]-6-methylpiperidine-3-carboxylic acid.
| Compound Name | 1-[(6-chloroquinolin-8-yl)methyl]-6-methylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122124482 |
| Molecular Formula | C17H19ClN2O2 |
| Molecular Weight | 318.80 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 1-[(6-chloroquinolin-8-yl)methyl]-6-methylpiperidine-3-carboxylic acid |
| SMILES | CC1CCC(C(=O)O)CN1Cc1cc(Cl)cc2cccnc12 |
| InChI | InChI=1S/C17H19ClN2O2/c1-11-4-5-13(17(21)22)9-20(11)10-14-8-15(18)7-12-3-2-6-19-16(12)14/h2-3,6-8,11,13H,4-5,9-10H2,1H3,(H,21,22) |
| InChIKey | AHJBFONHVAMGDJ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.80 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |