C22H29N3O2 — CID 122125103
1-[(1-cyclopentyl-5-phenylpyrazol-4-yl)methyl]-5-methylpiperidine-3-carboxylic acid (PubChem CID 122125103) has the molecular formula C22H29N3O2 and a molecular weight of 367.49 g/mol. Its IUPAC name is 1-[(1-cyclopentyl-5-phenylpyrazol-4-yl)methyl]-5-methylpiperidine-3-carboxylic acid.
| Compound Name | 1-[(1-cyclopentyl-5-phenylpyrazol-4-yl)methyl]-5-methylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122125103 |
| Molecular Formula | C22H29N3O2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | 1-[(1-cyclopentyl-5-phenylpyrazol-4-yl)methyl]-5-methylpiperidine-3-carboxylic acid |
| SMILES | CC1CC(C(=O)O)CN(Cc2cnn(C3CCCC3)c2-c2ccccc2)C1 |
| InChI | InChI=1S/C22H29N3O2/c1-16-11-18(22(26)27)14-24(13-16)15-19-12-23-25(20-9-5-6-10-20)21(19)17-7-3-2-4-8-17/h2-4,7-8,12,16,18,20H,5-6,9-11,13-15H2,1H3,(H,26,27) |
| InChIKey | IZQSKEOPOZKBCH-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |