C15H19BrClNO2 — CID 122125116
1-[(2-bromo-5-chloro-4-methylphenyl)methyl]-5-methylpiperidine-3-carboxylic acid (PubChem CID 122125116) has the molecular formula C15H19BrClNO2 and a molecular weight of 360.68 g/mol. Its IUPAC name is 1-[(2-bromo-5-chloro-4-methylphenyl)methyl]-5-methylpiperidine-3-carboxylic acid.
| Compound Name | 1-[(2-bromo-5-chloro-4-methylphenyl)methyl]-5-methylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122125116 |
| Molecular Formula | C15H19BrClNO2 |
| Molecular Weight | 360.68 g/mol |
| Exact Mass | 359.03 |
| IUPAC Name | 1-[(2-bromo-5-chloro-4-methylphenyl)methyl]-5-methylpiperidine-3-carboxylic acid |
| SMILES | Cc1cc(Br)c(CN2CC(C)CC(C(=O)O)C2)cc1Cl |
| InChI | InChI=1S/C15H19BrClNO2/c1-9-3-12(15(19)20)8-18(6-9)7-11-5-14(17)10(2)4-13(11)16/h4-5,9,12H,3,6-8H2,1-2H3,(H,19,20) |
| InChIKey | IEUNMJGUGYDODR-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.68 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |