About 1-[(2-ethyl-5-methyltriazol-4-yl)methyl]-2,3-dimethylguanidine
1-[(2-ethyl-5-methyltriazol-4-yl)methyl]-2,3-dimethylguanidine (PubChem CID 122125579) has the molecular formula C9H18N6
and a molecular weight of 210.28 g/mol. Its IUPAC name is 1-[(2-ethyl-5-methyltriazol-4-yl)methyl]-2,3-dimethylguanidine.
Molecular Properties
| Compound Name | 1-[(2-ethyl-5-methyltriazol-4-yl)methyl]-2,3-dimethylguanidine |
| PubChem CID | 122125579 |
| Molecular Formula | C9H18N6 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | 1-[(2-ethyl-5-methyltriazol-4-yl)methyl]-2,3-dimethylguanidine |
| SMILES | CCn1nc(C)c(CN/C(=N/C)NC)n1 |
| InChI | InChI=1S/C9H18N6/c1-5-15-13-7(2)8(14-15)6-12-9(10-3)11-4/h5-6H2,1-4H3,(H2,10,11,12) |
| InChIKey | HVVUMJWXHUOJJD-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2-ethyl-5-methyltriazol-4-yl)methyl]-2,3-dimethylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2-ethyl-5-methyltriazol-4-yl)methyl]-2,3-dimethylguanidine?
The IUPAC name of 1-[(2-ethyl-5-methyltriazol-4-yl)methyl]-2,3-dimethylguanidine (CID 122125579) is 1-[(2-ethyl-5-methyltriazol-4-yl)methyl]-2,3-dimethylguanidine.
What is the SMILES notation for 1-[(2-ethyl-5-methyltriazol-4-yl)methyl]-2,3-dimethylguanidine?
The canonical SMILES for 1-[(2-ethyl-5-methyltriazol-4-yl)methyl]-2,3-dimethylguanidine is CCn1nc(C)c(CN/C(=N/C)NC)n1.
What is the InChIKey of 1-[(2-ethyl-5-methyltriazol-4-yl)methyl]-2,3-dimethylguanidine?
The InChIKey is HVVUMJWXHUOJJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N6/c1-5-15-13-7(2)8(14-15)6-12-9(10-3)11-4/h5-6H2,1-4H3,(H2,10,11,12).
What are the key properties of 1-[(2-ethyl-5-methyltriazol-4-yl)methyl]-2,3-dimethylguanidine?
1-[(2-ethyl-5-methyltriazol-4-yl)methyl]-2,3-dimethylguanidine has a molecular weight of 210.28 g/mol, XLogP of -0.10, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-ethyl-5-methyltriazol-4-yl)methyl]-2,3-dimethylguanidine is sourced from PubChem (CID 122125579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).