C11H20IN3O — CID 122125588
N-[[(2S,3S)-2-ethenyloxolan-3-yl]methyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide (PubChem CID 122125588) has the molecular formula C11H20IN3O and a molecular weight of 337.21 g/mol. Its IUPAC name is N-[[(2S,3S)-2-ethenyloxolan-3-yl]methyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide.
| Compound Name | N-[[(2S,3S)-2-ethenyloxolan-3-yl]methyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide |
|---|---|
| PubChem CID | 122125588 |
| Molecular Formula | C11H20IN3O |
| Molecular Weight | 337.21 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | N-[[(2S,3S)-2-ethenyloxolan-3-yl]methyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide |
| SMILES | C=C[C@@H]1OCC[C@H]1CNC1=NCCCN1.I |
| InChI | InChI=1S/C11H19N3O.HI/c1-2-10-9(4-7-15-10)8-14-11-12-5-3-6-13-11;/h2,9-10H,1,3-8H2,(H2,12,13,14);1H/t9-,10-;/m0./s1 |
| InChIKey | XPJJQEMKTOLBOK-IYPAPVHQSA-N |
| XLogP | 1.13 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.21 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|