C12H23N3O — CID 122125591
2-[[(2S,3S)-2-ethenyloxolan-3-yl]methyl]-1,3-diethylguanidine (PubChem CID 122125591) has the molecular formula C12H23N3O and a molecular weight of 225.34 g/mol. Its IUPAC name is 2-[[(2S,3S)-2-ethenyloxolan-3-yl]methyl]-1,3-diethylguanidine.
| Compound Name | 2-[[(2S,3S)-2-ethenyloxolan-3-yl]methyl]-1,3-diethylguanidine |
|---|---|
| PubChem CID | 122125591 |
| Molecular Formula | C12H23N3O |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.18 |
| IUPAC Name | 2-[[(2S,3S)-2-ethenyloxolan-3-yl]methyl]-1,3-diethylguanidine |
| SMILES | C=C[C@@H]1OCC[C@H]1CN=C(NCC)NCC |
| InChI | InChI=1S/C12H23N3O/c1-4-11-10(7-8-16-11)9-15-12(13-5-2)14-6-3/h4,10-11H,1,5-9H2,2-3H3,(H2,13,14,15)/t10-,11-/m0/s1 |
| InChIKey | KUYWPYURDNOXMT-QWRGUYRKSA-N |
| XLogP | 1.15 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|