C14H26N4O — CID 122125931
N'-[(1-methyl-2-oxopiperidin-4-yl)methyl]azepane-1-carboximidamide (PubChem CID 122125931) has the molecular formula C14H26N4O and a molecular weight of 266.39 g/mol. Its IUPAC name is N'-[(1-methyl-2-oxopiperidin-4-yl)methyl]azepane-1-carboximidamide.
| Compound Name | N'-[(1-methyl-2-oxopiperidin-4-yl)methyl]azepane-1-carboximidamide |
|---|---|
| PubChem CID | 122125931 |
| Molecular Formula | C14H26N4O |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.21 |
| IUPAC Name | N'-[(1-methyl-2-oxopiperidin-4-yl)methyl]azepane-1-carboximidamide |
| SMILES | CN1CCC(C/N=C(\N)N2CCCCCC2)CC1=O |
| InChI | InChI=1S/C14H26N4O/c1-17-9-6-12(10-13(17)19)11-16-14(15)18-7-4-2-3-5-8-18/h12H,2-11H2,1H3,(H2,15,16) |
| InChIKey | ORICZNXDRJJPJD-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 61.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|