About 2-[[(5,6-dimethyl-1-benzofuran-3-carbonyl)amino]methyl]-2-ethylbutanoic acid
2-[[(5,6-dimethyl-1-benzofuran-3-carbonyl)amino]methyl]-2-ethylbutanoic acid (PubChem CID 122126237) has the molecular formula C18H23NO4
and a molecular weight of 317.39 g/mol. Its IUPAC name is 2-[[(5,6-dimethyl-1-benzofuran-3-carbonyl)amino]methyl]-2-ethylbutanoic acid.
Molecular Properties
| Compound Name | 2-[[(5,6-dimethyl-1-benzofuran-3-carbonyl)amino]methyl]-2-ethylbutanoic acid |
| PubChem CID | 122126237 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 2-[[(5,6-dimethyl-1-benzofuran-3-carbonyl)amino]methyl]-2-ethylbutanoic acid |
| SMILES | CCC(CC)(CNC(=O)c1coc2cc(C)c(C)cc12)C(=O)O |
| InChI | InChI=1S/C18H23NO4/c1-5-18(6-2,17(21)22)10-19-16(20)14-9-23-15-8-12(4)11(3)7-13(14)15/h7-9H,5-6,10H2,1-4H3,(H,19,20)(H,21,22) |
| InChIKey | MVTDVYXFHGSKKF-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[[(5,6-dimethyl-1-benzofuran-3-carbonyl)amino]methyl]-2-ethylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(5,6-dimethyl-1-benzofuran-3-carbonyl)amino]methyl]-2-ethylbutanoic acid?
The IUPAC name of 2-[[(5,6-dimethyl-1-benzofuran-3-carbonyl)amino]methyl]-2-ethylbutanoic acid (CID 122126237) is 2-[[(5,6-dimethyl-1-benzofuran-3-carbonyl)amino]methyl]-2-ethylbutanoic acid.
What is the SMILES notation for 2-[[(5,6-dimethyl-1-benzofuran-3-carbonyl)amino]methyl]-2-ethylbutanoic acid?
The canonical SMILES for 2-[[(5,6-dimethyl-1-benzofuran-3-carbonyl)amino]methyl]-2-ethylbutanoic acid is CCC(CC)(CNC(=O)c1coc2cc(C)c(C)cc12)C(=O)O.
What is the InChIKey of 2-[[(5,6-dimethyl-1-benzofuran-3-carbonyl)amino]methyl]-2-ethylbutanoic acid?
The InChIKey is MVTDVYXFHGSKKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23NO4/c1-5-18(6-2,17(21)22)10-19-16(20)14-9-23-15-8-12(4)11(3)7-13(14)15/h7-9H,5-6,10H2,1-4H3,(H,19,20)(H,21,22).
What are the key properties of 2-[[(5,6-dimethyl-1-benzofuran-3-carbonyl)amino]methyl]-2-ethylbutanoic acid?
2-[[(5,6-dimethyl-1-benzofuran-3-carbonyl)amino]methyl]-2-ethylbutanoic acid has a molecular weight of 317.39 g/mol, XLogP of 3.67, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(5,6-dimethyl-1-benzofuran-3-carbonyl)amino]methyl]-2-ethylbutanoic acid is sourced from PubChem (CID 122126237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).