About 4-[[1-(4-bromophenyl)-3-methylpyrazol-4-yl]methylamino]-2,2-dimethylbutanoic acid
4-[[1-(4-bromophenyl)-3-methylpyrazol-4-yl]methylamino]-2,2-dimethylbutanoic acid (PubChem CID 122127105) has the molecular formula C17H22BrN3O2
and a molecular weight of 380.29 g/mol. Its IUPAC name is 4-[[1-(4-bromophenyl)-3-methylpyrazol-4-yl]methylamino]-2,2-dimethylbutanoic acid.
Molecular Properties
| Compound Name | 4-[[1-(4-bromophenyl)-3-methylpyrazol-4-yl]methylamino]-2,2-dimethylbutanoic acid |
| PubChem CID | 122127105 |
| Molecular Formula | C17H22BrN3O2 |
| Molecular Weight | 380.29 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | 4-[[1-(4-bromophenyl)-3-methylpyrazol-4-yl]methylamino]-2,2-dimethylbutanoic acid |
| SMILES | Cc1nn(-c2ccc(Br)cc2)cc1CNCCC(C)(C)C(=O)O |
| InChI | InChI=1S/C17H22BrN3O2/c1-12-13(10-19-9-8-17(2,3)16(22)23)11-21(20-12)15-6-4-14(18)5-7-15/h4-7,11,19H,8-10H2,1-3H3,(H,22,23) |
| InChIKey | KLUVWSLOLKGHNF-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.29 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[[1-(4-bromophenyl)-3-methylpyrazol-4-yl]methylamino]-2,2-dimethylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[1-(4-bromophenyl)-3-methylpyrazol-4-yl]methylamino]-2,2-dimethylbutanoic acid?
The IUPAC name of 4-[[1-(4-bromophenyl)-3-methylpyrazol-4-yl]methylamino]-2,2-dimethylbutanoic acid (CID 122127105) is 4-[[1-(4-bromophenyl)-3-methylpyrazol-4-yl]methylamino]-2,2-dimethylbutanoic acid.
What is the SMILES notation for 4-[[1-(4-bromophenyl)-3-methylpyrazol-4-yl]methylamino]-2,2-dimethylbutanoic acid?
The canonical SMILES for 4-[[1-(4-bromophenyl)-3-methylpyrazol-4-yl]methylamino]-2,2-dimethylbutanoic acid is Cc1nn(-c2ccc(Br)cc2)cc1CNCCC(C)(C)C(=O)O.
What is the InChIKey of 4-[[1-(4-bromophenyl)-3-methylpyrazol-4-yl]methylamino]-2,2-dimethylbutanoic acid?
The InChIKey is KLUVWSLOLKGHNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22BrN3O2/c1-12-13(10-19-9-8-17(2,3)16(22)23)11-21(20-12)15-6-4-14(18)5-7-15/h4-7,11,19H,8-10H2,1-3H3,(H,22,23).
What are the key properties of 4-[[1-(4-bromophenyl)-3-methylpyrazol-4-yl]methylamino]-2,2-dimethylbutanoic acid?
4-[[1-(4-bromophenyl)-3-methylpyrazol-4-yl]methylamino]-2,2-dimethylbutanoic acid has a molecular weight of 380.29 g/mol, XLogP of 3.53, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[1-(4-bromophenyl)-3-methylpyrazol-4-yl]methylamino]-2,2-dimethylbutanoic acid is sourced from PubChem (CID 122127105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).