C11H15F3N2O2S — CID 122127409
2,2-dimethyl-4-[[5-(trifluoromethyl)-1,3-thiazol-2-yl]methylamino]butanoic acid (PubChem CID 122127409) has the molecular formula C11H15F3N2O2S and a molecular weight of 296.31 g/mol. Its IUPAC name is 2,2-dimethyl-4-[[5-(trifluoromethyl)-1,3-thiazol-2-yl]methylamino]butanoic acid.
| Compound Name | 2,2-dimethyl-4-[[5-(trifluoromethyl)-1,3-thiazol-2-yl]methylamino]butanoic acid |
|---|---|
| PubChem CID | 122127409 |
| Molecular Formula | C11H15F3N2O2S |
| Molecular Weight | 296.31 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 2,2-dimethyl-4-[[5-(trifluoromethyl)-1,3-thiazol-2-yl]methylamino]butanoic acid |
| SMILES | CC(C)(CCNCc1ncc(C(F)(F)F)s1)C(=O)O |
| InChI | InChI=1S/C11H15F3N2O2S/c1-10(2,9(17)18)3-4-15-6-8-16-5-7(19-8)11(12,13)14/h5,15H,3-4,6H2,1-2H3,(H,17,18) |
| InChIKey | DXDARYVVQCVXJF-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.31 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|