About 4-methyl-2-[[(3,3,5-trimethylcyclohexyl)amino]methyl]pentanoic acid
4-methyl-2-[[(3,3,5-trimethylcyclohexyl)amino]methyl]pentanoic acid (PubChem CID 122127730) has the molecular formula C16H31NO2
and a molecular weight of 269.43 g/mol. Its IUPAC name is 4-methyl-2-[[(3,3,5-trimethylcyclohexyl)amino]methyl]pentanoic acid.
Molecular Properties
| Compound Name | 4-methyl-2-[[(3,3,5-trimethylcyclohexyl)amino]methyl]pentanoic acid |
| PubChem CID | 122127730 |
| Molecular Formula | C16H31NO2 |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.24 |
| IUPAC Name | 4-methyl-2-[[(3,3,5-trimethylcyclohexyl)amino]methyl]pentanoic acid |
| SMILES | CC(C)CC(CNC1CC(C)CC(C)(C)C1)C(=O)O |
| InChI | InChI=1S/C16H31NO2/c1-11(2)6-13(15(18)19)10-17-14-7-12(3)8-16(4,5)9-14/h11-14,17H,6-10H2,1-5H3,(H,18,19) |
| InChIKey | OFKKRVMYPQETQI-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methyl-2-[[(3,3,5-trimethylcyclohexyl)amino]methyl]pentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2-[[(3,3,5-trimethylcyclohexyl)amino]methyl]pentanoic acid?
The IUPAC name of 4-methyl-2-[[(3,3,5-trimethylcyclohexyl)amino]methyl]pentanoic acid (CID 122127730) is 4-methyl-2-[[(3,3,5-trimethylcyclohexyl)amino]methyl]pentanoic acid.
What is the SMILES notation for 4-methyl-2-[[(3,3,5-trimethylcyclohexyl)amino]methyl]pentanoic acid?
The canonical SMILES for 4-methyl-2-[[(3,3,5-trimethylcyclohexyl)amino]methyl]pentanoic acid is CC(C)CC(CNC1CC(C)CC(C)(C)C1)C(=O)O.
What is the InChIKey of 4-methyl-2-[[(3,3,5-trimethylcyclohexyl)amino]methyl]pentanoic acid?
The InChIKey is OFKKRVMYPQETQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H31NO2/c1-11(2)6-13(15(18)19)10-17-14-7-12(3)8-16(4,5)9-14/h11-14,17H,6-10H2,1-5H3,(H,18,19).
What are the key properties of 4-methyl-2-[[(3,3,5-trimethylcyclohexyl)amino]methyl]pentanoic acid?
4-methyl-2-[[(3,3,5-trimethylcyclohexyl)amino]methyl]pentanoic acid has a molecular weight of 269.43 g/mol, XLogP of 3.54, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2-[[(3,3,5-trimethylcyclohexyl)amino]methyl]pentanoic acid is sourced from PubChem (CID 122127730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).