About 2-[[[4-(1,3-dioxoisoindol-2-yl)cyclohexyl]amino]methyl]-4-methylpentanoic acid
2-[[[4-(1,3-dioxoisoindol-2-yl)cyclohexyl]amino]methyl]-4-methylpentanoic acid (PubChem CID 122127968) has the molecular formula C21H28N2O4
and a molecular weight of 372.47 g/mol. Its IUPAC name is 2-[[[4-(1,3-dioxoisoindol-2-yl)cyclohexyl]amino]methyl]-4-methylpentanoic acid.
Molecular Properties
| Compound Name | 2-[[[4-(1,3-dioxoisoindol-2-yl)cyclohexyl]amino]methyl]-4-methylpentanoic acid |
| PubChem CID | 122127968 |
| Molecular Formula | C21H28N2O4 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | 2-[[[4-(1,3-dioxoisoindol-2-yl)cyclohexyl]amino]methyl]-4-methylpentanoic acid |
| SMILES | CC(C)CC(CNC1CCC(N2C(=O)c3ccccc3C2=O)CC1)C(=O)O |
| InChI | InChI=1S/C21H28N2O4/c1-13(2)11-14(21(26)27)12-22-15-7-9-16(10-8-15)23-19(24)17-5-3-4-6-18(17)20(23)25/h3-6,13-16,22H,7-12H2,1-2H3,(H,26,27) |
| InChIKey | GAWMKQWODOWDBU-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-[[[4-(1,3-dioxoisoindol-2-yl)cyclohexyl]amino]methyl]-4-methylpentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[[4-(1,3-dioxoisoindol-2-yl)cyclohexyl]amino]methyl]-4-methylpentanoic acid?
The IUPAC name of 2-[[[4-(1,3-dioxoisoindol-2-yl)cyclohexyl]amino]methyl]-4-methylpentanoic acid (CID 122127968) is 2-[[[4-(1,3-dioxoisoindol-2-yl)cyclohexyl]amino]methyl]-4-methylpentanoic acid.
What is the SMILES notation for 2-[[[4-(1,3-dioxoisoindol-2-yl)cyclohexyl]amino]methyl]-4-methylpentanoic acid?
The canonical SMILES for 2-[[[4-(1,3-dioxoisoindol-2-yl)cyclohexyl]amino]methyl]-4-methylpentanoic acid is CC(C)CC(CNC1CCC(N2C(=O)c3ccccc3C2=O)CC1)C(=O)O.
What is the InChIKey of 2-[[[4-(1,3-dioxoisoindol-2-yl)cyclohexyl]amino]methyl]-4-methylpentanoic acid?
The InChIKey is GAWMKQWODOWDBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H28N2O4/c1-13(2)11-14(21(26)27)12-22-15-7-9-16(10-8-15)23-19(24)17-5-3-4-6-18(17)20(23)25/h3-6,13-16,22H,7-12H2,1-2H3,(H,26,27).
What are the key properties of 2-[[[4-(1,3-dioxoisoindol-2-yl)cyclohexyl]amino]methyl]-4-methylpentanoic acid?
2-[[[4-(1,3-dioxoisoindol-2-yl)cyclohexyl]amino]methyl]-4-methylpentanoic acid has a molecular weight of 372.47 g/mol, XLogP of 2.93, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[[4-(1,3-dioxoisoindol-2-yl)cyclohexyl]amino]methyl]-4-methylpentanoic acid is sourced from PubChem (CID 122127968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).