About 2-[[[3-(2-ethoxy-1,1-difluoro-2-oxoethyl)cyclohexyl]amino]methyl]-2-ethylbutanoic acid
2-[[[3-(2-ethoxy-1,1-difluoro-2-oxoethyl)cyclohexyl]amino]methyl]-2-ethylbutanoic acid (PubChem CID 122128581) has the molecular formula C17H29F2NO4
and a molecular weight of 349.42 g/mol. Its IUPAC name is 2-[[[3-(2-ethoxy-1,1-difluoro-2-oxoethyl)cyclohexyl]amino]methyl]-2-ethylbutanoic acid.
Molecular Properties
| Compound Name | 2-[[[3-(2-ethoxy-1,1-difluoro-2-oxoethyl)cyclohexyl]amino]methyl]-2-ethylbutanoic acid |
| PubChem CID | 122128581 |
| Molecular Formula | C17H29F2NO4 |
| Molecular Weight | 349.42 g/mol |
| Exact Mass | 349.21 |
| IUPAC Name | 2-[[[3-(2-ethoxy-1,1-difluoro-2-oxoethyl)cyclohexyl]amino]methyl]-2-ethylbutanoic acid |
| SMILES | CCOC(=O)C(F)(F)C1CCCC(NCC(CC)(CC)C(=O)O)C1 |
| InChI | InChI=1S/C17H29F2NO4/c1-4-16(5-2,14(21)22)11-20-13-9-7-8-12(10-13)17(18,19)15(23)24-6-3/h12-13,20H,4-11H2,1-3H3,(H,21,22) |
| InChIKey | IOTFBZCYLSGNJJ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.42 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[[[3-(2-ethoxy-1,1-difluoro-2-oxoethyl)cyclohexyl]amino]methyl]-2-ethylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[[3-(2-ethoxy-1,1-difluoro-2-oxoethyl)cyclohexyl]amino]methyl]-2-ethylbutanoic acid?
The IUPAC name of 2-[[[3-(2-ethoxy-1,1-difluoro-2-oxoethyl)cyclohexyl]amino]methyl]-2-ethylbutanoic acid (CID 122128581) is 2-[[[3-(2-ethoxy-1,1-difluoro-2-oxoethyl)cyclohexyl]amino]methyl]-2-ethylbutanoic acid.
What is the SMILES notation for 2-[[[3-(2-ethoxy-1,1-difluoro-2-oxoethyl)cyclohexyl]amino]methyl]-2-ethylbutanoic acid?
The canonical SMILES for 2-[[[3-(2-ethoxy-1,1-difluoro-2-oxoethyl)cyclohexyl]amino]methyl]-2-ethylbutanoic acid is CCOC(=O)C(F)(F)C1CCCC(NCC(CC)(CC)C(=O)O)C1.
What is the InChIKey of 2-[[[3-(2-ethoxy-1,1-difluoro-2-oxoethyl)cyclohexyl]amino]methyl]-2-ethylbutanoic acid?
The InChIKey is IOTFBZCYLSGNJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H29F2NO4/c1-4-16(5-2,14(21)22)11-20-13-9-7-8-12(10-13)17(18,19)15(23)24-6-3/h12-13,20H,4-11H2,1-3H3,(H,21,22).
What are the key properties of 2-[[[3-(2-ethoxy-1,1-difluoro-2-oxoethyl)cyclohexyl]amino]methyl]-2-ethylbutanoic acid?
2-[[[3-(2-ethoxy-1,1-difluoro-2-oxoethyl)cyclohexyl]amino]methyl]-2-ethylbutanoic acid has a molecular weight of 349.42 g/mol, XLogP of 3.22, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[[3-(2-ethoxy-1,1-difluoro-2-oxoethyl)cyclohexyl]amino]methyl]-2-ethylbutanoic acid is sourced from PubChem (CID 122128581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).