About 2-[[[5-(2,6-difluorophenyl)-1H-pyrazol-4-yl]methylamino]methyl]-2-ethylbutanoic acid
2-[[[5-(2,6-difluorophenyl)-1H-pyrazol-4-yl]methylamino]methyl]-2-ethylbutanoic acid (PubChem CID 122128831) has the molecular formula C17H21F2N3O2
and a molecular weight of 337.37 g/mol. Its IUPAC name is 2-[[[5-(2,6-difluorophenyl)-1H-pyrazol-4-yl]methylamino]methyl]-2-ethylbutanoic acid.
Molecular Properties
| Compound Name | 2-[[[5-(2,6-difluorophenyl)-1H-pyrazol-4-yl]methylamino]methyl]-2-ethylbutanoic acid |
| PubChem CID | 122128831 |
| Molecular Formula | C17H21F2N3O2 |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | 2-[[[5-(2,6-difluorophenyl)-1H-pyrazol-4-yl]methylamino]methyl]-2-ethylbutanoic acid |
| SMILES | CCC(CC)(CNCc1cn[nH]c1-c1c(F)cccc1F)C(=O)O |
| InChI | InChI=1S/C17H21F2N3O2/c1-3-17(4-2,16(23)24)10-20-8-11-9-21-22-15(11)14-12(18)6-5-7-13(14)19/h5-7,9,20H,3-4,8,10H2,1-2H3,(H,21,22)(H,23,24) |
| InChIKey | WJJFRRYMEUCTJH-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[[[5-(2,6-difluorophenyl)-1H-pyrazol-4-yl]methylamino]methyl]-2-ethylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[[5-(2,6-difluorophenyl)-1H-pyrazol-4-yl]methylamino]methyl]-2-ethylbutanoic acid?
The IUPAC name of 2-[[[5-(2,6-difluorophenyl)-1H-pyrazol-4-yl]methylamino]methyl]-2-ethylbutanoic acid (CID 122128831) is 2-[[[5-(2,6-difluorophenyl)-1H-pyrazol-4-yl]methylamino]methyl]-2-ethylbutanoic acid.
What is the SMILES notation for 2-[[[5-(2,6-difluorophenyl)-1H-pyrazol-4-yl]methylamino]methyl]-2-ethylbutanoic acid?
The canonical SMILES for 2-[[[5-(2,6-difluorophenyl)-1H-pyrazol-4-yl]methylamino]methyl]-2-ethylbutanoic acid is CCC(CC)(CNCc1cn[nH]c1-c1c(F)cccc1F)C(=O)O.
What is the InChIKey of 2-[[[5-(2,6-difluorophenyl)-1H-pyrazol-4-yl]methylamino]methyl]-2-ethylbutanoic acid?
The InChIKey is WJJFRRYMEUCTJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21F2N3O2/c1-3-17(4-2,16(23)24)10-20-8-11-9-21-22-15(11)14-12(18)6-5-7-13(14)19/h5-7,9,20H,3-4,8,10H2,1-2H3,(H,21,22)(H,23,24).
What are the key properties of 2-[[[5-(2,6-difluorophenyl)-1H-pyrazol-4-yl]methylamino]methyl]-2-ethylbutanoic acid?
2-[[[5-(2,6-difluorophenyl)-1H-pyrazol-4-yl]methylamino]methyl]-2-ethylbutanoic acid has a molecular weight of 337.37 g/mol, XLogP of 3.34, 8 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[[5-(2,6-difluorophenyl)-1H-pyrazol-4-yl]methylamino]methyl]-2-ethylbutanoic acid is sourced from PubChem (CID 122128831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).