About 2-[[[2-(dimethylamino)-1,3-thiazol-5-yl]methylamino]methyl]-2-ethylbutanoic acid
2-[[[2-(dimethylamino)-1,3-thiazol-5-yl]methylamino]methyl]-2-ethylbutanoic acid (PubChem CID 122129108) has the molecular formula C13H23N3O2S
and a molecular weight of 285.41 g/mol. Its IUPAC name is 2-[[[2-(dimethylamino)-1,3-thiazol-5-yl]methylamino]methyl]-2-ethylbutanoic acid.
Molecular Properties
| Compound Name | 2-[[[2-(dimethylamino)-1,3-thiazol-5-yl]methylamino]methyl]-2-ethylbutanoic acid |
| PubChem CID | 122129108 |
| Molecular Formula | C13H23N3O2S |
| Molecular Weight | 285.41 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 2-[[[2-(dimethylamino)-1,3-thiazol-5-yl]methylamino]methyl]-2-ethylbutanoic acid |
| SMILES | CCC(CC)(CNCc1cnc(N(C)C)s1)C(=O)O |
| InChI | InChI=1S/C13H23N3O2S/c1-5-13(6-2,11(17)18)9-14-7-10-8-15-12(19-10)16(3)4/h8,14H,5-7,9H2,1-4H3,(H,17,18) |
| InChIKey | YRIDFHKKRZOJPW-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.41 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[[2-(dimethylamino)-1,3-thiazol-5-yl]methylamino]methyl]-2-ethylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[[2-(dimethylamino)-1,3-thiazol-5-yl]methylamino]methyl]-2-ethylbutanoic acid?
The IUPAC name of 2-[[[2-(dimethylamino)-1,3-thiazol-5-yl]methylamino]methyl]-2-ethylbutanoic acid (CID 122129108) is 2-[[[2-(dimethylamino)-1,3-thiazol-5-yl]methylamino]methyl]-2-ethylbutanoic acid.
What is the SMILES notation for 2-[[[2-(dimethylamino)-1,3-thiazol-5-yl]methylamino]methyl]-2-ethylbutanoic acid?
The canonical SMILES for 2-[[[2-(dimethylamino)-1,3-thiazol-5-yl]methylamino]methyl]-2-ethylbutanoic acid is CCC(CC)(CNCc1cnc(N(C)C)s1)C(=O)O.
What is the InChIKey of 2-[[[2-(dimethylamino)-1,3-thiazol-5-yl]methylamino]methyl]-2-ethylbutanoic acid?
The InChIKey is YRIDFHKKRZOJPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N3O2S/c1-5-13(6-2,11(17)18)9-14-7-10-8-15-12(19-10)16(3)4/h8,14H,5-7,9H2,1-4H3,(H,17,18).
What are the key properties of 2-[[[2-(dimethylamino)-1,3-thiazol-5-yl]methylamino]methyl]-2-ethylbutanoic acid?
2-[[[2-(dimethylamino)-1,3-thiazol-5-yl]methylamino]methyl]-2-ethylbutanoic acid has a molecular weight of 285.41 g/mol, XLogP of 2.19, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[[2-(dimethylamino)-1,3-thiazol-5-yl]methylamino]methyl]-2-ethylbutanoic acid is sourced from PubChem (CID 122129108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).