C18H22FNO2S — CID 122129153
2-ethyl-2-[[[5-(2-fluorophenyl)thiophen-2-yl]methylamino]methyl]butanoic acid (PubChem CID 122129153) has the molecular formula C18H22FNO2S and a molecular weight of 335.44 g/mol. Its IUPAC name is 2-ethyl-2-[[[5-(2-fluorophenyl)thiophen-2-yl]methylamino]methyl]butanoic acid.
| Compound Name | 2-ethyl-2-[[[5-(2-fluorophenyl)thiophen-2-yl]methylamino]methyl]butanoic acid |
|---|---|
| PubChem CID | 122129153 |
| Molecular Formula | C18H22FNO2S |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 2-ethyl-2-[[[5-(2-fluorophenyl)thiophen-2-yl]methylamino]methyl]butanoic acid |
| SMILES | CCC(CC)(CNCc1ccc(-c2ccccc2F)s1)C(=O)O |
| InChI | InChI=1S/C18H22FNO2S/c1-3-18(4-2,17(21)22)12-20-11-13-9-10-16(23-13)14-7-5-6-8-15(14)19/h5-10,20H,3-4,11-12H2,1-2H3,(H,21,22) |
| InChIKey | FWWNYWXETVVPMB-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |