About 4,6-dichlorofuro[2,3-b]pyridine
4,6-dichlorofuro[2,3-b]pyridine (PubChem CID 122129719) has the molecular formula C7H3Cl2NO
and a molecular weight of 188.01 g/mol. Its IUPAC name is 4,6-dichlorofuro[2,3-b]pyridine.
Molecular Properties
| Compound Name | 4,6-dichlorofuro[2,3-b]pyridine |
| PubChem CID | 122129719 |
| Molecular Formula | C7H3Cl2NO |
| Molecular Weight | 188.01 g/mol |
| Exact Mass | 186.96 |
| IUPAC Name | 4,6-dichlorofuro[2,3-b]pyridine |
| SMILES | Clc1cc(Cl)c2ccoc2n1 |
| InChI | InChI=1S/C7H3Cl2NO/c8-5-3-6(9)10-7-4(5)1-2-11-7/h1-3H |
| InChIKey | WLCLQVXRBAPFOV-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.01 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4,6-dichlorofuro[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dichlorofuro[2,3-b]pyridine?
The IUPAC name of 4,6-dichlorofuro[2,3-b]pyridine (CID 122129719) is 4,6-dichlorofuro[2,3-b]pyridine.
What is the SMILES notation for 4,6-dichlorofuro[2,3-b]pyridine?
The canonical SMILES for 4,6-dichlorofuro[2,3-b]pyridine is Clc1cc(Cl)c2ccoc2n1.
What is the InChIKey of 4,6-dichlorofuro[2,3-b]pyridine?
The InChIKey is WLCLQVXRBAPFOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3Cl2NO/c8-5-3-6(9)10-7-4(5)1-2-11-7/h1-3H.
What are the key properties of 4,6-dichlorofuro[2,3-b]pyridine?
4,6-dichlorofuro[2,3-b]pyridine has a molecular weight of 188.01 g/mol, XLogP of 3.13, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dichlorofuro[2,3-b]pyridine is sourced from PubChem (CID 122129719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).