About CID 122130275
CID 122130275 (PubChem CID 122130275) has the molecular formula C18H26Cl2Zr
and a molecular weight of 404.54 g/mol.
Molecular Properties
| Compound Name | CID 122130275 |
| PubChem CID | 122130275 |
| Molecular Formula | C18H26Cl2Zr |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | — |
| SMILES | CCC[C]1[CH][CH][C](C)[CH]1.CCC[C]1[CH][CH][C](C)[CH]1.Cl[Zr]Cl |
| InChI | InChI=1S/2C9H13.2ClH.Zr/c2*1-3-4-9-6-5-8(2)7-9;;;/h2*5-7H,3-4H2,1-2H3;2*1H;/q;;;;+2/p-2 |
| InChIKey | BFFXFEOVBDKKBJ-UHFFFAOYSA-L |
| XLogP | 6.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 122130275 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 122130275?
The IUPAC name of CID 122130275 (CID 122130275) is not available.
What is the SMILES notation for CID 122130275?
The canonical SMILES for CID 122130275 is CCC[C]1[CH][CH][C](C)[CH]1.CCC[C]1[CH][CH][C](C)[CH]1.Cl[Zr]Cl.
What is the InChIKey of CID 122130275?
The InChIKey is BFFXFEOVBDKKBJ-UHFFFAOYSA-L. The full InChI is InChI=1S/2C9H13.2ClH.Zr/c2*1-3-4-9-6-5-8(2)7-9;;;/h2*5-7H,3-4H2,1-2H3;2*1H;/q;;;;+2/p-2.
What are the key properties of CID 122130275?
CID 122130275 has a molecular weight of 404.54 g/mol, XLogP of 6.54, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 122130275 is sourced from PubChem (CID 122130275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).