C8H10N6NiO6 — CID 122130287
6-hydroxy-5-[(4-hydroxy-2,6-dioxo-1,3-diazinan-5-yl)diazenyl]-1,3-diazinane-2,4-dione;nickel (PubChem CID 122130287) has the molecular formula C8H10N6NiO6 and a molecular weight of 344.90 g/mol. Its IUPAC name is 6-hydroxy-5-[(4-hydroxy-2,6-dioxo-1,3-diazinan-5-yl)diazenyl]-1,3-diazinane-2,4-dione;nickel.
| Compound Name | 6-hydroxy-5-[(4-hydroxy-2,6-dioxo-1,3-diazinan-5-yl)diazenyl]-1,3-diazinane-2,4-dione;nickel |
|---|---|
| PubChem CID | 122130287 |
| Molecular Formula | C8H10N6NiO6 |
| Molecular Weight | 344.90 g/mol |
| Exact Mass | 344.00 |
| IUPAC Name | 6-hydroxy-5-[(4-hydroxy-2,6-dioxo-1,3-diazinan-5-yl)diazenyl]-1,3-diazinane-2,4-dione;nickel |
| SMILES | O=C1NC(=O)C(/N=N\C2C(=O)NC(=O)NC2O)C(O)N1.[Ni] |
| InChI | InChI=1S/C8H10N6O6.Ni/c15-3-1(4(16)10-7(19)9-3)13-14-2-5(17)11-8(20)12-6(2)18;/h1-3,5,15,17H,(H2,9,10,16,19)(H2,11,12,18,20);/b14-13-; |
| InChIKey | AVSDEUNPHCOZJX-HPWRNOGASA-N |
| XLogP | -3.51 |
| TPSA | 181.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.90 |
| LogP ≤ 5 | -3.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|