About (3-bromophenyl)-imino-methyl-oxo-λ6-sulfane
(3-bromophenyl)-imino-methyl-oxo-λ6-sulfane (PubChem CID 122130942) has the molecular formula C7H8BrNOS
and a molecular weight of 234.12 g/mol. Its IUPAC name is (3-bromophenyl)-imino-methyl-oxo-λ6-sulfane.
Molecular Properties
| Compound Name | (3-bromophenyl)-imino-methyl-oxo-λ6-sulfane |
| PubChem CID | 122130942 |
| Molecular Formula | C7H8BrNOS |
| Molecular Weight | 234.12 g/mol |
| Exact Mass | 232.95 |
| IUPAC Name | (3-bromophenyl)-imino-methyl-oxo-λ6-sulfane |
| SMILES | [H]N=S(C)(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C7H8BrNOS/c1-11(9,10)7-4-2-3-6(8)5-7/h2-5,9H,1H3 |
| InChIKey | WJVBEFFLTYIYPW-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.12 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3-bromophenyl)-imino-methyl-oxo-λ6-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-bromophenyl)-imino-methyl-oxo-λ6-sulfane?
The IUPAC name of (3-bromophenyl)-imino-methyl-oxo-λ6-sulfane (CID 122130942) is (3-bromophenyl)-imino-methyl-oxo-λ6-sulfane.
What is the SMILES notation for (3-bromophenyl)-imino-methyl-oxo-λ6-sulfane?
The canonical SMILES for (3-bromophenyl)-imino-methyl-oxo-λ6-sulfane is [H]N=S(C)(=O)c1cccc(Br)c1.
What is the InChIKey of (3-bromophenyl)-imino-methyl-oxo-λ6-sulfane?
The InChIKey is WJVBEFFLTYIYPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8BrNOS/c1-11(9,10)7-4-2-3-6(8)5-7/h2-5,9H,1H3.
What are the key properties of (3-bromophenyl)-imino-methyl-oxo-λ6-sulfane?
(3-bromophenyl)-imino-methyl-oxo-λ6-sulfane has a molecular weight of 234.12 g/mol, XLogP of 2.48, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-bromophenyl)-imino-methyl-oxo-λ6-sulfane is sourced from PubChem (CID 122130942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).