About 1-[3-(2,3-dimethylazetidin-1-yl)propyl]-4-propan-2-ylpiperazine;hydrobromide
1-[3-(2,3-dimethylazetidin-1-yl)propyl]-4-propan-2-ylpiperazine;hydrobromide (PubChem CID 122132331) has the molecular formula C15H32BrN3
and a molecular weight of 334.35 g/mol. Its IUPAC name is 1-[3-(2,3-dimethylazetidin-1-yl)propyl]-4-propan-2-ylpiperazine;hydrobromide.
Molecular Properties
| Compound Name | 1-[3-(2,3-dimethylazetidin-1-yl)propyl]-4-propan-2-ylpiperazine;hydrobromide |
| PubChem CID | 122132331 |
| Molecular Formula | C15H32BrN3 |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | 1-[3-(2,3-dimethylazetidin-1-yl)propyl]-4-propan-2-ylpiperazine;hydrobromide |
| SMILES | Br.CC1CN(CCCN2CCN(C(C)C)CC2)C1C |
| InChI | InChI=1S/C15H31N3.BrH/c1-13(2)17-10-8-16(9-11-17)6-5-7-18-12-14(3)15(18)4;/h13-15H,5-12H2,1-4H3;1H |
| InChIKey | ATPNWMUKQGNKMB-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[3-(2,3-dimethylazetidin-1-yl)propyl]-4-propan-2-ylpiperazine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(2,3-dimethylazetidin-1-yl)propyl]-4-propan-2-ylpiperazine;hydrobromide?
The IUPAC name of 1-[3-(2,3-dimethylazetidin-1-yl)propyl]-4-propan-2-ylpiperazine;hydrobromide (CID 122132331) is 1-[3-(2,3-dimethylazetidin-1-yl)propyl]-4-propan-2-ylpiperazine;hydrobromide.
What is the SMILES notation for 1-[3-(2,3-dimethylazetidin-1-yl)propyl]-4-propan-2-ylpiperazine;hydrobromide?
The canonical SMILES for 1-[3-(2,3-dimethylazetidin-1-yl)propyl]-4-propan-2-ylpiperazine;hydrobromide is Br.CC1CN(CCCN2CCN(C(C)C)CC2)C1C.
What is the InChIKey of 1-[3-(2,3-dimethylazetidin-1-yl)propyl]-4-propan-2-ylpiperazine;hydrobromide?
The InChIKey is ATPNWMUKQGNKMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H31N3.BrH/c1-13(2)17-10-8-16(9-11-17)6-5-7-18-12-14(3)15(18)4;/h13-15H,5-12H2,1-4H3;1H.
What are the key properties of 1-[3-(2,3-dimethylazetidin-1-yl)propyl]-4-propan-2-ylpiperazine;hydrobromide?
1-[3-(2,3-dimethylazetidin-1-yl)propyl]-4-propan-2-ylpiperazine;hydrobromide has a molecular weight of 334.35 g/mol, XLogP of 2.32, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(2,3-dimethylazetidin-1-yl)propyl]-4-propan-2-ylpiperazine;hydrobromide is sourced from PubChem (CID 122132331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).