C14H18F3N3O — CID 122132603
6-methyl-4-[5-(trifluoromethyl)-2-pyridinyl]-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazine (PubChem CID 122132603) has the molecular formula C14H18F3N3O and a molecular weight of 301.31 g/mol. Its IUPAC name is 6-methyl-4-[5-(trifluoromethyl)-2-pyridinyl]-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazine.
| Compound Name | 6-methyl-4-[5-(trifluoromethyl)-2-pyridinyl]-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazine |
|---|---|
| PubChem CID | 122132603 |
| Molecular Formula | C14H18F3N3O |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 6-methyl-4-[5-(trifluoromethyl)-2-pyridinyl]-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazine |
| SMILES | CN1CCC2OCCN(c3ccc(C(F)(F)F)cn3)C2C1 |
| InChI | InChI=1S/C14H18F3N3O/c1-19-5-4-12-11(9-19)20(6-7-21-12)13-3-2-10(8-18-13)14(15,16)17/h2-3,8,11-12H,4-7,9H2,1H3 |
| InChIKey | VEYKLGHONCLXOQ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |