C10H11F3N4O — CID 122132949
1-(6-cyclopropylpyridazin-3-yl)-3-(2,2,2-trifluoroethyl)urea (PubChem CID 122132949) has the molecular formula C10H11F3N4O and a molecular weight of 260.22 g/mol. Its IUPAC name is 1-(6-cyclopropylpyridazin-3-yl)-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-(6-cyclopropylpyridazin-3-yl)-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 122132949 |
| Molecular Formula | C10H11F3N4O |
| Molecular Weight | 260.22 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | 1-(6-cyclopropylpyridazin-3-yl)-3-(2,2,2-trifluoroethyl)urea |
| SMILES | O=C(NCC(F)(F)F)Nc1ccc(C2CC2)nn1 |
| InChI | InChI=1S/C10H11F3N4O/c11-10(12,13)5-14-9(18)15-8-4-3-7(16-17-8)6-1-2-6/h3-4,6H,1-2,5H2,(H2,14,15,17,18) |
| InChIKey | OMYANTSZIXARQA-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.22 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |