C16H22N4S2 — CID 122133959
N,N'-dimethyl-N,N'-bis[(2-methyl-1,3-thiazol-5-yl)methyl]but-2-yne-1,4-diamine (PubChem CID 122133959) has the molecular formula C16H22N4S2 and a molecular weight of 334.51 g/mol. Its IUPAC name is N,N'-dimethyl-N,N'-bis[(2-methyl-1,3-thiazol-5-yl)methyl]but-2-yne-1,4-diamine.
| Compound Name | N,N'-dimethyl-N,N'-bis[(2-methyl-1,3-thiazol-5-yl)methyl]but-2-yne-1,4-diamine |
|---|---|
| PubChem CID | 122133959 |
| Molecular Formula | C16H22N4S2 |
| Molecular Weight | 334.51 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | N,N'-dimethyl-N,N'-bis[(2-methyl-1,3-thiazol-5-yl)methyl]but-2-yne-1,4-diamine |
| SMILES | Cc1ncc(CN(C)CC#CCN(C)Cc2cnc(C)s2)s1 |
| InChI | InChI=1S/C16H22N4S2/c1-13-17-9-15(21-13)11-19(3)7-5-6-8-20(4)12-16-10-18-14(2)22-16/h9-10H,7-8,11-12H2,1-4H3 |
| InChIKey | FRVUHKJNGLFOSK-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.51 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|