C17H24N4O3 — CID 122134713
2,1,3-benzoxadiazol-5-yl-[4-[3-(dimethylamino)propoxy]piperidin-1-yl]methanone (PubChem CID 122134713) has the molecular formula C17H24N4O3 and a molecular weight of 332.40 g/mol. Its IUPAC name is 2,1,3-benzoxadiazol-5-yl-[4-[3-(dimethylamino)propoxy]piperidin-1-yl]methanone.
| Compound Name | 2,1,3-benzoxadiazol-5-yl-[4-[3-(dimethylamino)propoxy]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 122134713 |
| Molecular Formula | C17H24N4O3 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | 2,1,3-benzoxadiazol-5-yl-[4-[3-(dimethylamino)propoxy]piperidin-1-yl]methanone |
| SMILES | CN(C)CCCOC1CCN(C(=O)c2ccc3nonc3c2)CC1 |
| InChI | InChI=1S/C17H24N4O3/c1-20(2)8-3-11-23-14-6-9-21(10-7-14)17(22)13-4-5-15-16(12-13)19-24-18-15/h4-5,12,14H,3,6-11H2,1-2H3 |
| InChIKey | BLGJLRSXOHYBNY-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 71.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|