C17H19F2NO2S — CID 122135317
1-(2,4-difluorophenyl)-N-[(4-ethylsulfonylphenyl)methyl]ethanamine (PubChem CID 122135317) has the molecular formula C17H19F2NO2S and a molecular weight of 339.41 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-N-[(4-ethylsulfonylphenyl)methyl]ethanamine.
| Compound Name | 1-(2,4-difluorophenyl)-N-[(4-ethylsulfonylphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 122135317 |
| Molecular Formula | C17H19F2NO2S |
| Molecular Weight | 339.41 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 1-(2,4-difluorophenyl)-N-[(4-ethylsulfonylphenyl)methyl]ethanamine |
| SMILES | CCS(=O)(=O)c1ccc(CNC(C)c2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C17H19F2NO2S/c1-3-23(21,22)15-7-4-13(5-8-15)11-20-12(2)16-9-6-14(18)10-17(16)19/h4-10,12,20H,3,11H2,1-2H3 |
| InChIKey | MMZLSBVXUDAJDE-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.41 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |