C16H21F3N2O2 — CID 122135677
2-[methyl-[(3,4,5-trifluorophenyl)methyl]amino]-N-(oxolan-2-ylmethyl)propanamide (PubChem CID 122135677) has the molecular formula C16H21F3N2O2 and a molecular weight of 330.35 g/mol. Its IUPAC name is 2-[methyl-[(3,4,5-trifluorophenyl)methyl]amino]-N-(oxolan-2-ylmethyl)propanamide.
| Compound Name | 2-[methyl-[(3,4,5-trifluorophenyl)methyl]amino]-N-(oxolan-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 122135677 |
| Molecular Formula | C16H21F3N2O2 |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 2-[methyl-[(3,4,5-trifluorophenyl)methyl]amino]-N-(oxolan-2-ylmethyl)propanamide |
| SMILES | CC(C(=O)NCC1CCCO1)N(C)Cc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C16H21F3N2O2/c1-10(16(22)20-8-12-4-3-5-23-12)21(2)9-11-6-13(17)15(19)14(18)7-11/h6-7,10,12H,3-5,8-9H2,1-2H3,(H,20,22) |
| InChIKey | IYRJYKLIOORTGW-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|