C14H14N4O3 — CID 122136744
methyl 2-[(3-aminopyrazine-2-carbonyl)amino]-5-methylbenzoate (PubChem CID 122136744) has the molecular formula C14H14N4O3 and a molecular weight of 286.29 g/mol. Its IUPAC name is methyl 2-[(3-aminopyrazine-2-carbonyl)amino]-5-methylbenzoate.
| Compound Name | methyl 2-[(3-aminopyrazine-2-carbonyl)amino]-5-methylbenzoate |
|---|---|
| PubChem CID | 122136744 |
| Molecular Formula | C14H14N4O3 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | methyl 2-[(3-aminopyrazine-2-carbonyl)amino]-5-methylbenzoate |
| SMILES | COC(=O)c1cc(C)ccc1NC(=O)c1nccnc1N |
| InChI | InChI=1S/C14H14N4O3/c1-8-3-4-10(9(7-8)14(20)21-2)18-13(19)11-12(15)17-6-5-16-11/h3-7H,1-2H3,(H2,15,17)(H,18,19) |
| InChIKey | QECSWONFGQOECQ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |