About 1-but-2-ynyl-7-phenyl-1,4-diazepan-5-one
1-but-2-ynyl-7-phenyl-1,4-diazepan-5-one (PubChem CID 122137393) has the molecular formula C15H18N2O
and a molecular weight of 242.32 g/mol. Its IUPAC name is 1-but-2-ynyl-7-phenyl-1,4-diazepan-5-one.
Molecular Properties
| Compound Name | 1-but-2-ynyl-7-phenyl-1,4-diazepan-5-one |
| PubChem CID | 122137393 |
| Molecular Formula | C15H18N2O |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | 1-but-2-ynyl-7-phenyl-1,4-diazepan-5-one |
| SMILES | CC#CCN1CCNC(=O)CC1c1ccccc1 |
| InChI | InChI=1S/C15H18N2O/c1-2-3-10-17-11-9-16-15(18)12-14(17)13-7-5-4-6-8-13/h4-8,14H,9-12H2,1H3,(H,16,18) |
| InChIKey | JIUBBLQBVVQMRZ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-but-2-ynyl-7-phenyl-1,4-diazepan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-but-2-ynyl-7-phenyl-1,4-diazepan-5-one?
The IUPAC name of 1-but-2-ynyl-7-phenyl-1,4-diazepan-5-one (CID 122137393) is 1-but-2-ynyl-7-phenyl-1,4-diazepan-5-one.
What is the SMILES notation for 1-but-2-ynyl-7-phenyl-1,4-diazepan-5-one?
The canonical SMILES for 1-but-2-ynyl-7-phenyl-1,4-diazepan-5-one is CC#CCN1CCNC(=O)CC1c1ccccc1.
What is the InChIKey of 1-but-2-ynyl-7-phenyl-1,4-diazepan-5-one?
The InChIKey is JIUBBLQBVVQMRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O/c1-2-3-10-17-11-9-16-15(18)12-14(17)13-7-5-4-6-8-13/h4-8,14H,9-12H2,1H3,(H,16,18).
What are the key properties of 1-but-2-ynyl-7-phenyl-1,4-diazepan-5-one?
1-but-2-ynyl-7-phenyl-1,4-diazepan-5-one has a molecular weight of 242.32 g/mol, XLogP of 1.57, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-but-2-ynyl-7-phenyl-1,4-diazepan-5-one is sourced from PubChem (CID 122137393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).