C17H24N6O2 — CID 122137908
N,6-dimethyl-5-nitro-N-[1-(2-pyrazol-1-ylethyl)piperidin-4-yl]pyridin-2-amine (PubChem CID 122137908) has the molecular formula C17H24N6O2 and a molecular weight of 344.42 g/mol. Its IUPAC name is N,6-dimethyl-5-nitro-N-[1-(2-pyrazol-1-ylethyl)piperidin-4-yl]pyridin-2-amine.
| Compound Name | N,6-dimethyl-5-nitro-N-[1-(2-pyrazol-1-ylethyl)piperidin-4-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 122137908 |
| Molecular Formula | C17H24N6O2 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | N,6-dimethyl-5-nitro-N-[1-(2-pyrazol-1-ylethyl)piperidin-4-yl]pyridin-2-amine |
| SMILES | Cc1nc(N(C)C2CCN(CCn3cccn3)CC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H24N6O2/c1-14-16(23(24)25)4-5-17(19-14)20(2)15-6-10-21(11-7-15)12-13-22-9-3-8-18-22/h3-5,8-9,15H,6-7,10-13H2,1-2H3 |
| InChIKey | KGAKDWVWRFQKCV-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 80.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|