C19H20N2O4 — CID 122138174
N-[(1-hydroxy-2,3-dihydroinden-1-yl)methyl]-3-(3-nitrophenyl)propanamide (PubChem CID 122138174) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is N-[(1-hydroxy-2,3-dihydroinden-1-yl)methyl]-3-(3-nitrophenyl)propanamide.
| Compound Name | N-[(1-hydroxy-2,3-dihydroinden-1-yl)methyl]-3-(3-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 122138174 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | N-[(1-hydroxy-2,3-dihydroinden-1-yl)methyl]-3-(3-nitrophenyl)propanamide |
| SMILES | O=C(CCc1cccc([N+](=O)[O-])c1)NCC1(O)CCc2ccccc21 |
| InChI | InChI=1S/C19H20N2O4/c22-18(9-8-14-4-3-6-16(12-14)21(24)25)20-13-19(23)11-10-15-5-1-2-7-17(15)19/h1-7,12,23H,8-11,13H2,(H,20,22) |
| InChIKey | XTYHPKLGOWYWFY-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|