C20H26N4O — CID 122138602
2-methyl-1-(3-methyl-1-benzofuran-2-yl)-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)propan-1-amine (PubChem CID 122138602) has the molecular formula C20H26N4O and a molecular weight of 338.45 g/mol. Its IUPAC name is 2-methyl-1-(3-methyl-1-benzofuran-2-yl)-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)propan-1-amine.
| Compound Name | 2-methyl-1-(3-methyl-1-benzofuran-2-yl)-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)propan-1-amine |
|---|---|
| PubChem CID | 122138602 |
| Molecular Formula | C20H26N4O |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | 2-methyl-1-(3-methyl-1-benzofuran-2-yl)-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)propan-1-amine |
| SMILES | Cc1c(C(NCc2nnc3n2CCCC3)C(C)C)oc2ccccc12 |
| InChI | InChI=1S/C20H26N4O/c1-13(2)19(20-14(3)15-8-4-5-9-16(15)25-20)21-12-18-23-22-17-10-6-7-11-24(17)18/h4-5,8-9,13,19,21H,6-7,10-12H2,1-3H3 |
| InChIKey | NUVDNKLCFCKNCS-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 55.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |