About 2-[[5-(1H-pyrazol-5-yl)furan-2-yl]methylamino]-2,3-dihydro-1H-inden-1-ol
2-[[5-(1H-pyrazol-5-yl)furan-2-yl]methylamino]-2,3-dihydro-1H-inden-1-ol (PubChem CID 122139562) has the molecular formula C17H17N3O2
and a molecular weight of 295.34 g/mol. Its IUPAC name is 2-[[5-(1H-pyrazol-5-yl)furan-2-yl]methylamino]-2,3-dihydro-1H-inden-1-ol.
Molecular Properties
| Compound Name | 2-[[5-(1H-pyrazol-5-yl)furan-2-yl]methylamino]-2,3-dihydro-1H-inden-1-ol |
| PubChem CID | 122139562 |
| Molecular Formula | C17H17N3O2 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 2-[[5-(1H-pyrazol-5-yl)furan-2-yl]methylamino]-2,3-dihydro-1H-inden-1-ol |
| SMILES | OC1c2ccccc2CC1NCc1ccc(-c2ccn[nH]2)o1 |
| InChI | InChI=1S/C17H17N3O2/c21-17-13-4-2-1-3-11(13)9-15(17)18-10-12-5-6-16(22-12)14-7-8-19-20-14/h1-8,15,17-18,21H,9-10H2,(H,19,20) |
| InChIKey | SLJGXABHEAEGED-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 74.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[[5-(1H-pyrazol-5-yl)furan-2-yl]methylamino]-2,3-dihydro-1H-inden-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[5-(1H-pyrazol-5-yl)furan-2-yl]methylamino]-2,3-dihydro-1H-inden-1-ol?
The IUPAC name of 2-[[5-(1H-pyrazol-5-yl)furan-2-yl]methylamino]-2,3-dihydro-1H-inden-1-ol (CID 122139562) is 2-[[5-(1H-pyrazol-5-yl)furan-2-yl]methylamino]-2,3-dihydro-1H-inden-1-ol.
What is the SMILES notation for 2-[[5-(1H-pyrazol-5-yl)furan-2-yl]methylamino]-2,3-dihydro-1H-inden-1-ol?
The canonical SMILES for 2-[[5-(1H-pyrazol-5-yl)furan-2-yl]methylamino]-2,3-dihydro-1H-inden-1-ol is OC1c2ccccc2CC1NCc1ccc(-c2ccn[nH]2)o1.
What is the InChIKey of 2-[[5-(1H-pyrazol-5-yl)furan-2-yl]methylamino]-2,3-dihydro-1H-inden-1-ol?
The InChIKey is SLJGXABHEAEGED-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17N3O2/c21-17-13-4-2-1-3-11(13)9-15(17)18-10-12-5-6-16(22-12)14-7-8-19-20-14/h1-8,15,17-18,21H,9-10H2,(H,19,20).
What are the key properties of 2-[[5-(1H-pyrazol-5-yl)furan-2-yl]methylamino]-2,3-dihydro-1H-inden-1-ol?
2-[[5-(1H-pyrazol-5-yl)furan-2-yl]methylamino]-2,3-dihydro-1H-inden-1-ol has a molecular weight of 295.34 g/mol, XLogP of 2.42, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[5-(1H-pyrazol-5-yl)furan-2-yl]methylamino]-2,3-dihydro-1H-inden-1-ol is sourced from PubChem (CID 122139562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).