C17H20F3NO3 — CID 122139598
1-(1,7-dimethyl-2,6-dioxa-9-azaspiro[4.5]decan-9-yl)-2-(2,4,5-trifluorophenyl)ethanone (PubChem CID 122139598) has the molecular formula C17H20F3NO3 and a molecular weight of 343.35 g/mol. Its IUPAC name is 1-(1,7-dimethyl-2,6-dioxa-9-azaspiro[4.5]decan-9-yl)-2-(2,4,5-trifluorophenyl)ethanone.
| Compound Name | 1-(1,7-dimethyl-2,6-dioxa-9-azaspiro[4.5]decan-9-yl)-2-(2,4,5-trifluorophenyl)ethanone |
|---|---|
| PubChem CID | 122139598 |
| Molecular Formula | C17H20F3NO3 |
| Molecular Weight | 343.35 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 1-(1,7-dimethyl-2,6-dioxa-9-azaspiro[4.5]decan-9-yl)-2-(2,4,5-trifluorophenyl)ethanone |
| SMILES | CC1CN(C(=O)Cc2cc(F)c(F)cc2F)CC2(CCOC2C)O1 |
| InChI | InChI=1S/C17H20F3NO3/c1-10-8-21(9-17(24-10)3-4-23-11(17)2)16(22)6-12-5-14(19)15(20)7-13(12)18/h5,7,10-11H,3-4,6,8-9H2,1-2H3 |
| InChIKey | CDFMGSBKIRFOOV-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.35 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|