C15H23NO4 — CID 122139655
methyl (3aS,7aS)-2-(3,4-dihydro-2H-pyran-2-ylmethyl)-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylate (PubChem CID 122139655) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is methyl (3aS,7aS)-2-(3,4-dihydro-2H-pyran-2-ylmethyl)-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylate.
| Compound Name | methyl (3aS,7aS)-2-(3,4-dihydro-2H-pyran-2-ylmethyl)-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylate |
|---|---|
| PubChem CID | 122139655 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | methyl (3aS,7aS)-2-(3,4-dihydro-2H-pyran-2-ylmethyl)-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylate |
| SMILES | COC(=O)[C@@]12CCOC[C@@H]1CN(CC1CCC=CO1)C2 |
| InChI | InChI=1S/C15H23NO4/c1-18-14(17)15-5-7-19-10-12(15)8-16(11-15)9-13-4-2-3-6-20-13/h3,6,12-13H,2,4-5,7-11H2,1H3/t12-,13?,15+/m0/s1 |
| InChIKey | NSIQDNNPLNRRRF-RMTCENKZSA-N |
| XLogP | 1.19 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |