About N-(6-bromoimidazo[1,2-a]pyrazin-2-yl)-2-cyclopropylpropanamide
N-(6-bromoimidazo[1,2-a]pyrazin-2-yl)-2-cyclopropylpropanamide (PubChem CID 122140381) has the molecular formula C12H13BrN4O
and a molecular weight of 309.17 g/mol. Its IUPAC name is N-(6-bromoimidazo[1,2-a]pyrazin-2-yl)-2-cyclopropylpropanamide.
Molecular Properties
| Compound Name | N-(6-bromoimidazo[1,2-a]pyrazin-2-yl)-2-cyclopropylpropanamide |
| PubChem CID | 122140381 |
| Molecular Formula | C12H13BrN4O |
| Molecular Weight | 309.17 g/mol |
| Exact Mass | 308.03 |
| IUPAC Name | N-(6-bromoimidazo[1,2-a]pyrazin-2-yl)-2-cyclopropylpropanamide |
| SMILES | CC(C(=O)Nc1cn2cc(Br)ncc2n1)C1CC1 |
| InChI | InChI=1S/C12H13BrN4O/c1-7(8-2-3-8)12(18)16-10-6-17-5-9(13)14-4-11(17)15-10/h4-8H,2-3H2,1H3,(H,16,18) |
| InChIKey | HUAGQPGWKCKBEV-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.17 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(6-bromoimidazo[1,2-a]pyrazin-2-yl)-2-cyclopropylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-bromoimidazo[1,2-a]pyrazin-2-yl)-2-cyclopropylpropanamide?
The IUPAC name of N-(6-bromoimidazo[1,2-a]pyrazin-2-yl)-2-cyclopropylpropanamide (CID 122140381) is N-(6-bromoimidazo[1,2-a]pyrazin-2-yl)-2-cyclopropylpropanamide.
What is the SMILES notation for N-(6-bromoimidazo[1,2-a]pyrazin-2-yl)-2-cyclopropylpropanamide?
The canonical SMILES for N-(6-bromoimidazo[1,2-a]pyrazin-2-yl)-2-cyclopropylpropanamide is CC(C(=O)Nc1cn2cc(Br)ncc2n1)C1CC1.
What is the InChIKey of N-(6-bromoimidazo[1,2-a]pyrazin-2-yl)-2-cyclopropylpropanamide?
The InChIKey is HUAGQPGWKCKBEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13BrN4O/c1-7(8-2-3-8)12(18)16-10-6-17-5-9(13)14-4-11(17)15-10/h4-8H,2-3H2,1H3,(H,16,18).
What are the key properties of N-(6-bromoimidazo[1,2-a]pyrazin-2-yl)-2-cyclopropylpropanamide?
N-(6-bromoimidazo[1,2-a]pyrazin-2-yl)-2-cyclopropylpropanamide has a molecular weight of 309.17 g/mol, XLogP of 2.48, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-bromoimidazo[1,2-a]pyrazin-2-yl)-2-cyclopropylpropanamide is sourced from PubChem (CID 122140381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).