C19H23N3O4S — CID 122140778
N-(1-benzylsulfonylpiperidin-4-yl)-5-cyclopropyl-1,2-oxazole-3-carboxamide (PubChem CID 122140778) has the molecular formula C19H23N3O4S and a molecular weight of 389.48 g/mol. Its IUPAC name is N-(1-benzylsulfonylpiperidin-4-yl)-5-cyclopropyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-(1-benzylsulfonylpiperidin-4-yl)-5-cyclopropyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 122140778 |
| Molecular Formula | C19H23N3O4S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | N-(1-benzylsulfonylpiperidin-4-yl)-5-cyclopropyl-1,2-oxazole-3-carboxamide |
| SMILES | O=C(NC1CCN(S(=O)(=O)Cc2ccccc2)CC1)c1cc(C2CC2)on1 |
| InChI | InChI=1S/C19H23N3O4S/c23-19(17-12-18(26-21-17)15-6-7-15)20-16-8-10-22(11-9-16)27(24,25)13-14-4-2-1-3-5-14/h1-5,12,15-16H,6-11,13H2,(H,20,23) |
| InChIKey | ZVOLOLFADKQHEO-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |