C16H23NO4 — CID 122141053
3-cyclopentyloxy-N-(1,3-dihydroxy-2-methylpropan-2-yl)benzamide (PubChem CID 122141053) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is 3-cyclopentyloxy-N-(1,3-dihydroxy-2-methylpropan-2-yl)benzamide.
| Compound Name | 3-cyclopentyloxy-N-(1,3-dihydroxy-2-methylpropan-2-yl)benzamide |
|---|---|
| PubChem CID | 122141053 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 3-cyclopentyloxy-N-(1,3-dihydroxy-2-methylpropan-2-yl)benzamide |
| SMILES | CC(CO)(CO)NC(=O)c1cccc(OC2CCCC2)c1 |
| InChI | InChI=1S/C16H23NO4/c1-16(10-18,11-19)17-15(20)12-5-4-8-14(9-12)21-13-6-2-3-7-13/h4-5,8-9,13,18-19H,2-3,6-7,10-11H2,1H3,(H,17,20) |
| InChIKey | XSRAUFMZMLXPFJ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |