About ethyl 5-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]furan-2-carboxylate
ethyl 5-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]furan-2-carboxylate (PubChem CID 122141670) has the molecular formula C13H15N3O5S
and a molecular weight of 325.35 g/mol. Its IUPAC name is ethyl 5-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]furan-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]furan-2-carboxylate |
| PubChem CID | 122141670 |
| Molecular Formula | C13H15N3O5S |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | ethyl 5-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]furan-2-carboxylate |
| SMILES | CCOC(=O)c1ccc(S(=O)(=O)Nc2nc(C)cc(C)n2)o1 |
| InChI | InChI=1S/C13H15N3O5S/c1-4-20-12(17)10-5-6-11(21-10)22(18,19)16-13-14-8(2)7-9(3)15-13/h5-7H,4H2,1-3H3,(H,14,15,16) |
| InChIKey | KDDSOKYDVSTYKJ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 5-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]furan-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]furan-2-carboxylate?
The IUPAC name of ethyl 5-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]furan-2-carboxylate (CID 122141670) is ethyl 5-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]furan-2-carboxylate.
What is the SMILES notation for ethyl 5-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]furan-2-carboxylate?
The canonical SMILES for ethyl 5-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]furan-2-carboxylate is CCOC(=O)c1ccc(S(=O)(=O)Nc2nc(C)cc(C)n2)o1.
What is the InChIKey of ethyl 5-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]furan-2-carboxylate?
The InChIKey is KDDSOKYDVSTYKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N3O5S/c1-4-20-12(17)10-5-6-11(21-10)22(18,19)16-13-14-8(2)7-9(3)15-13/h5-7H,4H2,1-3H3,(H,14,15,16).
What are the key properties of ethyl 5-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]furan-2-carboxylate?
ethyl 5-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]furan-2-carboxylate has a molecular weight of 325.35 g/mol, XLogP of 1.66, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]furan-2-carboxylate is sourced from PubChem (CID 122141670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).