C17H15N3O3 — CID 122141693
N-(1,2-oxazol-5-ylmethyl)-2-phenylmethoxypyridine-4-carboxamide (PubChem CID 122141693) has the molecular formula C17H15N3O3 and a molecular weight of 309.33 g/mol. Its IUPAC name is N-(1,2-oxazol-5-ylmethyl)-2-phenylmethoxypyridine-4-carboxamide.
| Compound Name | N-(1,2-oxazol-5-ylmethyl)-2-phenylmethoxypyridine-4-carboxamide |
|---|---|
| PubChem CID | 122141693 |
| Molecular Formula | C17H15N3O3 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | N-(1,2-oxazol-5-ylmethyl)-2-phenylmethoxypyridine-4-carboxamide |
| SMILES | O=C(NCc1ccno1)c1ccnc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C17H15N3O3/c21-17(19-11-15-7-9-20-23-15)14-6-8-18-16(10-14)22-12-13-4-2-1-3-5-13/h1-10H,11-12H2,(H,19,21) |
| InChIKey | ZERMNXJGTKTIKH-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |