About 7-[2-(2,2-difluoroethoxy)ethoxy]-1,2-benzoxazole
7-[2-(2,2-difluoroethoxy)ethoxy]-1,2-benzoxazole (PubChem CID 122142281) has the molecular formula C11H11F2NO3
and a molecular weight of 243.21 g/mol. Its IUPAC name is 7-[2-(2,2-difluoroethoxy)ethoxy]-1,2-benzoxazole.
Molecular Properties
| Compound Name | 7-[2-(2,2-difluoroethoxy)ethoxy]-1,2-benzoxazole |
| PubChem CID | 122142281 |
| Molecular Formula | C11H11F2NO3 |
| Molecular Weight | 243.21 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | 7-[2-(2,2-difluoroethoxy)ethoxy]-1,2-benzoxazole |
| SMILES | FC(F)COCCOc1cccc2cnoc12 |
| InChI | InChI=1S/C11H11F2NO3/c12-10(13)7-15-4-5-16-9-3-1-2-8-6-14-17-11(8)9/h1-3,6,10H,4-5,7H2 |
| InChIKey | KVPDDYRLJRWXJR-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.21 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-[2-(2,2-difluoroethoxy)ethoxy]-1,2-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[2-(2,2-difluoroethoxy)ethoxy]-1,2-benzoxazole?
The IUPAC name of 7-[2-(2,2-difluoroethoxy)ethoxy]-1,2-benzoxazole (CID 122142281) is 7-[2-(2,2-difluoroethoxy)ethoxy]-1,2-benzoxazole.
What is the SMILES notation for 7-[2-(2,2-difluoroethoxy)ethoxy]-1,2-benzoxazole?
The canonical SMILES for 7-[2-(2,2-difluoroethoxy)ethoxy]-1,2-benzoxazole is FC(F)COCCOc1cccc2cnoc12.
What is the InChIKey of 7-[2-(2,2-difluoroethoxy)ethoxy]-1,2-benzoxazole?
The InChIKey is KVPDDYRLJRWXJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11F2NO3/c12-10(13)7-15-4-5-16-9-3-1-2-8-6-14-17-11(8)9/h1-3,6,10H,4-5,7H2.
What are the key properties of 7-[2-(2,2-difluoroethoxy)ethoxy]-1,2-benzoxazole?
7-[2-(2,2-difluoroethoxy)ethoxy]-1,2-benzoxazole has a molecular weight of 243.21 g/mol, XLogP of 2.49, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[2-(2,2-difluoroethoxy)ethoxy]-1,2-benzoxazole is sourced from PubChem (CID 122142281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).