C16H19N3O4S — CID 122142610
N-[2-(methanesulfonamido)-5-methylphenyl]-2-pyridin-3-yloxypropanamide (PubChem CID 122142610) has the molecular formula C16H19N3O4S and a molecular weight of 349.41 g/mol. Its IUPAC name is N-[2-(methanesulfonamido)-5-methylphenyl]-2-pyridin-3-yloxypropanamide.
| Compound Name | N-[2-(methanesulfonamido)-5-methylphenyl]-2-pyridin-3-yloxypropanamide |
|---|---|
| PubChem CID | 122142610 |
| Molecular Formula | C16H19N3O4S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | N-[2-(methanesulfonamido)-5-methylphenyl]-2-pyridin-3-yloxypropanamide |
| SMILES | Cc1ccc(NS(C)(=O)=O)c(NC(=O)C(C)Oc2cccnc2)c1 |
| InChI | InChI=1S/C16H19N3O4S/c1-11-6-7-14(19-24(3,21)22)15(9-11)18-16(20)12(2)23-13-5-4-8-17-10-13/h4-10,12,19H,1-3H3,(H,18,20) |
| InChIKey | FTNRKZFDOHRRRI-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |