About 3-[1-(3,4-dichlorophenyl)ethylsulfonylmethyl]oxolane
3-[1-(3,4-dichlorophenyl)ethylsulfonylmethyl]oxolane (PubChem CID 122142906) has the molecular formula C13H16Cl2O3S
and a molecular weight of 323.24 g/mol. Its IUPAC name is 3-[1-(3,4-dichlorophenyl)ethylsulfonylmethyl]oxolane.
Molecular Properties
| Compound Name | 3-[1-(3,4-dichlorophenyl)ethylsulfonylmethyl]oxolane |
| PubChem CID | 122142906 |
| Molecular Formula | C13H16Cl2O3S |
| Molecular Weight | 323.24 g/mol |
| Exact Mass | 322.02 |
| IUPAC Name | 3-[1-(3,4-dichlorophenyl)ethylsulfonylmethyl]oxolane |
| SMILES | CC(c1ccc(Cl)c(Cl)c1)S(=O)(=O)CC1CCOC1 |
| InChI | InChI=1S/C13H16Cl2O3S/c1-9(11-2-3-12(14)13(15)6-11)19(16,17)8-10-4-5-18-7-10/h2-3,6,9-10H,4-5,7-8H2,1H3 |
| InChIKey | RKCYTUMQORJKNP-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.24 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[1-(3,4-dichlorophenyl)ethylsulfonylmethyl]oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-(3,4-dichlorophenyl)ethylsulfonylmethyl]oxolane?
The IUPAC name of 3-[1-(3,4-dichlorophenyl)ethylsulfonylmethyl]oxolane (CID 122142906) is 3-[1-(3,4-dichlorophenyl)ethylsulfonylmethyl]oxolane.
What is the SMILES notation for 3-[1-(3,4-dichlorophenyl)ethylsulfonylmethyl]oxolane?
The canonical SMILES for 3-[1-(3,4-dichlorophenyl)ethylsulfonylmethyl]oxolane is CC(c1ccc(Cl)c(Cl)c1)S(=O)(=O)CC1CCOC1.
What is the InChIKey of 3-[1-(3,4-dichlorophenyl)ethylsulfonylmethyl]oxolane?
The InChIKey is RKCYTUMQORJKNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16Cl2O3S/c1-9(11-2-3-12(14)13(15)6-11)19(16,17)8-10-4-5-18-7-10/h2-3,6,9-10H,4-5,7-8H2,1H3.
What are the key properties of 3-[1-(3,4-dichlorophenyl)ethylsulfonylmethyl]oxolane?
3-[1-(3,4-dichlorophenyl)ethylsulfonylmethyl]oxolane has a molecular weight of 323.24 g/mol, XLogP of 3.51, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(3,4-dichlorophenyl)ethylsulfonylmethyl]oxolane is sourced from PubChem (CID 122142906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).