About 3,3-difluoro-2,2-dimethyl-1-(2-methyl-6-thiophen-3-ylmorpholin-4-yl)propan-1-one
3,3-difluoro-2,2-dimethyl-1-(2-methyl-6-thiophen-3-ylmorpholin-4-yl)propan-1-one (PubChem CID 122144375) has the molecular formula C14H19F2NO2S
and a molecular weight of 303.37 g/mol. Its IUPAC name is 3,3-difluoro-2,2-dimethyl-1-(2-methyl-6-thiophen-3-ylmorpholin-4-yl)propan-1-one.
Molecular Properties
| Compound Name | 3,3-difluoro-2,2-dimethyl-1-(2-methyl-6-thiophen-3-ylmorpholin-4-yl)propan-1-one |
| PubChem CID | 122144375 |
| Molecular Formula | C14H19F2NO2S |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 3,3-difluoro-2,2-dimethyl-1-(2-methyl-6-thiophen-3-ylmorpholin-4-yl)propan-1-one |
| SMILES | CC1CN(C(=O)C(C)(C)C(F)F)CC(c2ccsc2)O1 |
| InChI | InChI=1S/C14H19F2NO2S/c1-9-6-17(13(18)14(2,3)12(15)16)7-11(19-9)10-4-5-20-8-10/h4-5,8-9,11-12H,6-7H2,1-3H3 |
| InChIKey | ZUMNBKNHGCJXQY-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,3-difluoro-2,2-dimethyl-1-(2-methyl-6-thiophen-3-ylmorpholin-4-yl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-difluoro-2,2-dimethyl-1-(2-methyl-6-thiophen-3-ylmorpholin-4-yl)propan-1-one?
The IUPAC name of 3,3-difluoro-2,2-dimethyl-1-(2-methyl-6-thiophen-3-ylmorpholin-4-yl)propan-1-one (CID 122144375) is 3,3-difluoro-2,2-dimethyl-1-(2-methyl-6-thiophen-3-ylmorpholin-4-yl)propan-1-one.
What is the SMILES notation for 3,3-difluoro-2,2-dimethyl-1-(2-methyl-6-thiophen-3-ylmorpholin-4-yl)propan-1-one?
The canonical SMILES for 3,3-difluoro-2,2-dimethyl-1-(2-methyl-6-thiophen-3-ylmorpholin-4-yl)propan-1-one is CC1CN(C(=O)C(C)(C)C(F)F)CC(c2ccsc2)O1.
What is the InChIKey of 3,3-difluoro-2,2-dimethyl-1-(2-methyl-6-thiophen-3-ylmorpholin-4-yl)propan-1-one?
The InChIKey is ZUMNBKNHGCJXQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19F2NO2S/c1-9-6-17(13(18)14(2,3)12(15)16)7-11(19-9)10-4-5-20-8-10/h4-5,8-9,11-12H,6-7H2,1-3H3.
What are the key properties of 3,3-difluoro-2,2-dimethyl-1-(2-methyl-6-thiophen-3-ylmorpholin-4-yl)propan-1-one?
3,3-difluoro-2,2-dimethyl-1-(2-methyl-6-thiophen-3-ylmorpholin-4-yl)propan-1-one has a molecular weight of 303.37 g/mol, XLogP of 3.33, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-difluoro-2,2-dimethyl-1-(2-methyl-6-thiophen-3-ylmorpholin-4-yl)propan-1-one is sourced from PubChem (CID 122144375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).