C14H19N5O2S — CID 122145561
1-(1-ethyl-3-methyl-4-nitropyrazol-5-yl)-4-thiophen-2-ylpiperazine (PubChem CID 122145561) has the molecular formula C14H19N5O2S and a molecular weight of 321.41 g/mol. Its IUPAC name is 1-(1-ethyl-3-methyl-4-nitropyrazol-5-yl)-4-thiophen-2-ylpiperazine.
| Compound Name | 1-(1-ethyl-3-methyl-4-nitropyrazol-5-yl)-4-thiophen-2-ylpiperazine |
|---|---|
| PubChem CID | 122145561 |
| Molecular Formula | C14H19N5O2S |
| Molecular Weight | 321.41 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | 1-(1-ethyl-3-methyl-4-nitropyrazol-5-yl)-4-thiophen-2-ylpiperazine |
| SMILES | CCn1nc(C)c([N+](=O)[O-])c1N1CCN(c2cccs2)CC1 |
| InChI | InChI=1S/C14H19N5O2S/c1-3-18-14(13(19(20)21)11(2)15-18)17-8-6-16(7-9-17)12-5-4-10-22-12/h4-5,10H,3,6-9H2,1-2H3 |
| InChIKey | SWWFTSXGSHJSSO-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 67.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.41 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|