C21H22N2O3 — CID 122146155
3-[benzyl-(6-methyl-1H-indole-2-carbonyl)amino]-2-methylpropanoic acid (PubChem CID 122146155) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is 3-[benzyl-(6-methyl-1H-indole-2-carbonyl)amino]-2-methylpropanoic acid.
| Compound Name | 3-[benzyl-(6-methyl-1H-indole-2-carbonyl)amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 122146155 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 3-[benzyl-(6-methyl-1H-indole-2-carbonyl)amino]-2-methylpropanoic acid |
| SMILES | Cc1ccc2cc(C(=O)N(Cc3ccccc3)CC(C)C(=O)O)[nH]c2c1 |
| InChI | InChI=1S/C21H22N2O3/c1-14-8-9-17-11-19(22-18(17)10-14)20(24)23(12-15(2)21(25)26)13-16-6-4-3-5-7-16/h3-11,15,22H,12-13H2,1-2H3,(H,25,26) |
| InChIKey | GYRLLHOSXKYRIB-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |