About 2-fluoro-N-[4-[2-methoxyethyl(methyl)sulfamoyl]phenyl]-N,2-dimethylpropanamide
2-fluoro-N-[4-[2-methoxyethyl(methyl)sulfamoyl]phenyl]-N,2-dimethylpropanamide (PubChem CID 122146733) has the molecular formula C15H23FN2O4S
and a molecular weight of 346.42 g/mol. Its IUPAC name is 2-fluoro-N-[4-[2-methoxyethyl(methyl)sulfamoyl]phenyl]-N,2-dimethylpropanamide.
Molecular Properties
| Compound Name | 2-fluoro-N-[4-[2-methoxyethyl(methyl)sulfamoyl]phenyl]-N,2-dimethylpropanamide |
| PubChem CID | 122146733 |
| Molecular Formula | C15H23FN2O4S |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 2-fluoro-N-[4-[2-methoxyethyl(methyl)sulfamoyl]phenyl]-N,2-dimethylpropanamide |
| SMILES | COCCN(C)S(=O)(=O)c1ccc(N(C)C(=O)C(C)(C)F)cc1 |
| InChI | InChI=1S/C15H23FN2O4S/c1-15(2,16)14(19)18(4)12-6-8-13(9-7-12)23(20,21)17(3)10-11-22-5/h6-9H,10-11H2,1-5H3 |
| InChIKey | DORASASOBNYTDN-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-fluoro-N-[4-[2-methoxyethyl(methyl)sulfamoyl]phenyl]-N,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-N-[4-[2-methoxyethyl(methyl)sulfamoyl]phenyl]-N,2-dimethylpropanamide?
The IUPAC name of 2-fluoro-N-[4-[2-methoxyethyl(methyl)sulfamoyl]phenyl]-N,2-dimethylpropanamide (CID 122146733) is 2-fluoro-N-[4-[2-methoxyethyl(methyl)sulfamoyl]phenyl]-N,2-dimethylpropanamide.
What is the SMILES notation for 2-fluoro-N-[4-[2-methoxyethyl(methyl)sulfamoyl]phenyl]-N,2-dimethylpropanamide?
The canonical SMILES for 2-fluoro-N-[4-[2-methoxyethyl(methyl)sulfamoyl]phenyl]-N,2-dimethylpropanamide is COCCN(C)S(=O)(=O)c1ccc(N(C)C(=O)C(C)(C)F)cc1.
What is the InChIKey of 2-fluoro-N-[4-[2-methoxyethyl(methyl)sulfamoyl]phenyl]-N,2-dimethylpropanamide?
The InChIKey is DORASASOBNYTDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23FN2O4S/c1-15(2,16)14(19)18(4)12-6-8-13(9-7-12)23(20,21)17(3)10-11-22-5/h6-9H,10-11H2,1-5H3.
What are the key properties of 2-fluoro-N-[4-[2-methoxyethyl(methyl)sulfamoyl]phenyl]-N,2-dimethylpropanamide?
2-fluoro-N-[4-[2-methoxyethyl(methyl)sulfamoyl]phenyl]-N,2-dimethylpropanamide has a molecular weight of 346.42 g/mol, XLogP of 1.66, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-N-[4-[2-methoxyethyl(methyl)sulfamoyl]phenyl]-N,2-dimethylpropanamide is sourced from PubChem (CID 122146733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).